C21H24FN7O3S — CID 172871592
4-acetyl-N-[2-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 172871592) has the molecular formula C21H24FN7O3S and a molecular weight of 473.53 g/mol. Its IUPAC name is 4-acetyl-N-[2-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-[2-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 172871592 |
| Molecular Formula | C21H24FN7O3S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4-acetyl-N-[2-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCCNc2nc(Nc3ccc(F)cc3)nc(N(C)C)n2)cc1 |
| InChI | InChI=1S/C21H24FN7O3S/c1-14(30)15-4-10-18(11-5-15)33(31,32)24-13-12-23-19-26-20(28-21(27-19)29(2)3)25-17-8-6-16(22)7-9-17/h4-11,24H,12-13H2,1-3H3,(H2,23,25,26,27,28) |
| InChIKey | JZRJAZPGOXEMIQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|