C37H39N3O10 — CID 172872286
[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoate (PubChem CID 172872286) has the molecular formula C37H39N3O10 and a molecular weight of 685.73 g/mol. Its IUPAC name is [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoate.
| Compound Name | [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoate |
|---|---|
| PubChem CID | 172872286 |
| Molecular Formula | C37H39N3O10 |
| Molecular Weight | 685.73 g/mol |
| Exact Mass | 685.26 |
| IUPAC Name | [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoate |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OC(=O)CCCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C37H39N3O10/c1-46-27-16-14-22(12-13-23-20-29(47-2)34(49-4)30(21-23)48-3)19-28(27)50-32(42)11-6-5-7-18-38-25-10-8-9-24-33(25)37(45)40(36(24)44)26-15-17-31(41)39-35(26)43/h8-10,12-14,16,19-21,26,38H,5-7,11,15,17-18H2,1-4H3,(H,39,41,43)/b13-12- |
| InChIKey | QXCITHRZQTUQSO-SEYXRHQNSA-N |
| XLogP | 4.87 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.73 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|