C26H48N6O7P+ — CID 172873579
2-amino-9-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)-1H-purin-6-one;tetrabutylazanium (PubChem CID 172873579) has the molecular formula C26H48N6O7P+ and a molecular weight of 587.68 g/mol. Its IUPAC name is 2-amino-9-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)-1H-purin-6-one;tetrabutylazanium.
| Compound Name | 2-amino-9-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)-1H-purin-6-one;tetrabutylazanium |
|---|---|
| PubChem CID | 172873579 |
| Molecular Formula | C26H48N6O7P+ |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | 2-amino-9-(2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)-1H-purin-6-one;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Nc1nc2c(ncn2C2OC3COP(=O)(O)OC3C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H36N.C10H12N5O7P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6/h5-16H2,1-4H3;2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17)/q+1; |
| InChIKey | XIBHGXYDWVRXED-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|