C17H15ClN4S — CID 172874456
7-(2-chloro-3,4,5,6-tetradeuteriophenyl)-4-ethyl-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 172874456) has the molecular formula C17H15ClN4S and a molecular weight of 346.88 g/mol. Its IUPAC name is 7-(2-chloro-3,4,5,6-tetradeuteriophenyl)-4-ethyl-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(2-chloro-3,4,5,6-tetradeuteriophenyl)-4-ethyl-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 172874456 |
| Molecular Formula | C17H15ClN4S |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 7-(2-chloro-3,4,5,6-tetradeuteriophenyl)-4-ethyl-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | [2H]c1c([2H])c([2H])c(C2=NCc3nnc(C)n3-c3sc(CC)cc32)c(Cl)c1[2H] |
| InChI | InChI=1S/C17H15ClN4S/c1-3-11-8-13-16(12-6-4-5-7-14(12)18)19-9-15-21-20-10(2)22(15)17(13)23-11/h4-8H,3,9H2,1-2H3/i4D,5D,6D,7D |
| InChIKey | VMZUTJCNQWMAGF-UGWFXTGHSA-N |
| XLogP | 4.20 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |