C27H36N6O4S — CID 172875048
1-[3-[4-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]azetidin-1-yl]ethanone (PubChem CID 172875048) has the molecular formula C27H36N6O4S and a molecular weight of 540.69 g/mol. Its IUPAC name is 1-[3-[4-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]azetidin-1-yl]ethanone.
| Compound Name | 1-[3-[4-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 172875048 |
| Molecular Formula | C27H36N6O4S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 1-[3-[4-[(5R)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-5,7-dimethyl-5,11-dihydropyrimido[5,4-c][1,5]benzoxazepin-9-yl]piperidin-1-yl]azetidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(N2CCC(c3cc(C)c4c(c3)Nc3ncnc(N5CCS(=O)(=O)CC5)c3[C@@H](C)O4)CC2)C1 |
| InChI | InChI=1S/C27H36N6O4S/c1-17-12-21(20-4-6-31(7-5-20)22-14-33(15-22)19(3)34)13-23-25(17)37-18(2)24-26(30-23)28-16-29-27(24)32-8-10-38(35,36)11-9-32/h12-13,16,18,20,22H,4-11,14-15H2,1-3H3,(H,28,29,30)/t18-/m1/s1 |
| InChIKey | VFSZSVNLAQBKOO-GOSISDBHSA-N |
| XLogP | 2.63 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |