C36H39ClFN7O2 — CID 172875272
2-[4-[7-(8-chloronaphthalen-1-yl)-2-[(1-pent-4-ynylpyrrolidin-2-yl)methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile (PubChem CID 172875272) has the molecular formula C36H39ClFN7O2 and a molecular weight of 656.21 g/mol. Its IUPAC name is 2-[4-[7-(8-chloronaphthalen-1-yl)-2-[(1-pent-4-ynylpyrrolidin-2-yl)methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-[7-(8-chloronaphthalen-1-yl)-2-[(1-pent-4-ynylpyrrolidin-2-yl)methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 172875272 |
| Molecular Formula | C36H39ClFN7O2 |
| Molecular Weight | 656.21 g/mol |
| Exact Mass | 655.28 |
| IUPAC Name | 2-[4-[7-(8-chloronaphthalen-1-yl)-2-[(1-pent-4-ynylpyrrolidin-2-yl)methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile |
| SMILES | C#CCCCN1CCCC1COc1nc2c(c(N3CCN(C(=O)C(=C)F)C(CC#N)C3)n1)CCN(c1cccc3cccc(Cl)c13)C2 |
| InChI | InChI=1S/C36H39ClFN7O2/c1-3-4-5-17-42-18-8-11-28(42)24-47-36-40-31-23-43(32-13-7-10-26-9-6-12-30(37)33(26)32)19-15-29(31)34(41-36)44-20-21-45(35(46)25(2)38)27(22-44)14-16-39/h1,6-7,9-10,12-13,27-28H,2,4-5,8,11,14-15,17-24H2 |
| InChIKey | YUPCFANWZUHYAJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 88.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.21 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|