C24H45NO4 — CID 172875760
(2S)-4,5,5,5-tetradeuterio-2-[[(Z)-18-hydroxyoctadec-9-enoyl]amino]-4-(trideuteriomethyl)pentanoic acid (PubChem CID 172875760) has the molecular formula C24H45NO4 and a molecular weight of 418.67 g/mol. Its IUPAC name is (2S)-4,5,5,5-tetradeuterio-2-[[(Z)-18-hydroxyoctadec-9-enoyl]amino]-4-(trideuteriomethyl)pentanoic acid.
| Compound Name | (2S)-4,5,5,5-tetradeuterio-2-[[(Z)-18-hydroxyoctadec-9-enoyl]amino]-4-(trideuteriomethyl)pentanoic acid |
|---|---|
| PubChem CID | 172875760 |
| Molecular Formula | C24H45NO4 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.38 |
| IUPAC Name | (2S)-4,5,5,5-tetradeuterio-2-[[(Z)-18-hydroxyoctadec-9-enoyl]amino]-4-(trideuteriomethyl)pentanoic acid |
| SMILES | [2H]C([2H])([2H])C([2H])(C[C@H](NC(=O)CCCCCCC/C=C\CCCCCCCCO)C(=O)O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C24H45NO4/c1-21(2)20-22(24(28)29)25-23(27)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-26/h3-4,21-22,26H,5-20H2,1-2H3,(H,25,27)(H,28,29)/b4-3-/t22-/m0/s1/i1D3,2D3,21D |
| InChIKey | GIKMMUHIVFGOLN-ULAHKAFASA-N |
| XLogP | 5.61 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|