C15H11BrFNO — CID 172876011
(4-bromo-1,3-dihydroisoindol-2-yl)-(2-fluorophenyl)methanone (PubChem CID 172876011) has the molecular formula C15H11BrFNO and a molecular weight of 320.16 g/mol. Its IUPAC name is (4-bromo-1,3-dihydroisoindol-2-yl)-(2-fluorophenyl)methanone.
| Compound Name | (4-bromo-1,3-dihydroisoindol-2-yl)-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 172876011 |
| Molecular Formula | C15H11BrFNO |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | (4-bromo-1,3-dihydroisoindol-2-yl)-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1Cc2cccc(Br)c2C1 |
| InChI | InChI=1S/C15H11BrFNO/c16-13-6-3-4-10-8-18(9-12(10)13)15(19)11-5-1-2-7-14(11)17/h1-7H,8-9H2 |
| InChIKey | IFEIEOLSFGPHCP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |