About 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one
4-(2-methylphenyl)-2,3-dihydroisoindol-1-one (PubChem CID 172876033) has the molecular formula C15H13NO
and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one |
| PubChem CID | 172876033 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one |
| SMILES | Cc1ccccc1-c1cccc2c1CNC2=O |
| InChI | InChI=1S/C15H13NO/c1-10-5-2-3-6-11(10)12-7-4-8-13-14(12)9-16-15(13)17/h2-8H,9H2,1H3,(H,16,17) |
| InChIKey | HDULIXVBOGDGDG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one?
The IUPAC name of 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one (CID 172876033) is 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one?
The canonical SMILES for 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one is Cc1ccccc1-c1cccc2c1CNC2=O.
What is the InChIKey of 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one?
The InChIKey is HDULIXVBOGDGDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO/c1-10-5-2-3-6-11(10)12-7-4-8-13-14(12)9-16-15(13)17/h2-8H,9H2,1H3,(H,16,17).
What are the key properties of 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one?
4-(2-methylphenyl)-2,3-dihydroisoindol-1-one has a molecular weight of 223.28 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenyl)-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 172876033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).