C22H15NO4 — CID 172876431
N-(1,4-benzodioxin-6-yl)-N-phenyl-1,4-benzodioxin-6-amine (PubChem CID 172876431) has the molecular formula C22H15NO4 and a molecular weight of 357.37 g/mol. Its IUPAC name is N-(1,4-benzodioxin-6-yl)-N-phenyl-1,4-benzodioxin-6-amine.
| Compound Name | N-(1,4-benzodioxin-6-yl)-N-phenyl-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 172876431 |
| Molecular Formula | C22H15NO4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-(1,4-benzodioxin-6-yl)-N-phenyl-1,4-benzodioxin-6-amine |
| SMILES | C1=COc2cc(N(c3ccccc3)c3ccc4c(c3)OC=CO4)ccc2O1 |
| InChI | InChI=1S/C22H15NO4/c1-2-4-16(5-3-1)23(17-6-8-19-21(14-17)26-12-10-24-19)18-7-9-20-22(15-18)27-13-11-25-20/h1-15H |
| InChIKey | LOKDULSIFZMVFM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |