About 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine
1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine (PubChem CID 172876555) has the molecular formula C14H18BrF2N
and a molecular weight of 318.20 g/mol. Its IUPAC name is 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine.
Molecular Properties
| Compound Name | 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine |
| PubChem CID | 172876555 |
| Molecular Formula | C14H18BrF2N |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine |
| SMILES | Cc1cc(Br)cc(C)c1CN1CCCC(F)(F)C1 |
| InChI | InChI=1S/C14H18BrF2N/c1-10-6-12(15)7-11(2)13(10)8-18-5-3-4-14(16,17)9-18/h6-7H,3-5,8-9H2,1-2H3 |
| InChIKey | VPNNKCOXZSQQIE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine?
The IUPAC name of 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine (CID 172876555) is 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine.
What is the SMILES notation for 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine?
The canonical SMILES for 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine is Cc1cc(Br)cc(C)c1CN1CCCC(F)(F)C1.
What is the InChIKey of 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine?
The InChIKey is VPNNKCOXZSQQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrF2N/c1-10-6-12(15)7-11(2)13(10)8-18-5-3-4-14(16,17)9-18/h6-7H,3-5,8-9H2,1-2H3.
What are the key properties of 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine?
1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine has a molecular weight of 318.20 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-bromo-2,6-dimethylphenyl)methyl]-3,3-difluoropiperidine is sourced from PubChem (CID 172876555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).