About [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol
[2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol (PubChem CID 172876876) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol |
| PubChem CID | 172876876 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol |
| SMILES | Cc1cc(-c2cnn(S(=O)(=O)C(C)C)c2)cc(C)c1CO |
| InChI | InChI=1S/C15H20N2O3S/c1-10(2)21(19,20)17-8-14(7-16-17)13-5-11(3)15(9-18)12(4)6-13/h5-8,10,18H,9H2,1-4H3 |
| InChIKey | YHLKSLYQBCNIBL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol?
The IUPAC name of [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol (CID 172876876) is [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol.
What is the SMILES notation for [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol?
The canonical SMILES for [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol is Cc1cc(-c2cnn(S(=O)(=O)C(C)C)c2)cc(C)c1CO.
What is the InChIKey of [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol?
The InChIKey is YHLKSLYQBCNIBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-10(2)21(19,20)17-8-14(7-16-17)13-5-11(3)15(9-18)12(4)6-13/h5-8,10,18H,9H2,1-4H3.
What are the key properties of [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol?
[2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol has a molecular weight of 308.40 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dimethyl-4-(1-propan-2-ylsulfonylpyrazol-4-yl)phenyl]methanol is sourced from PubChem (CID 172876876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).