About 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one
5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one (PubChem CID 172877104) has the molecular formula C24H24O4
and a molecular weight of 376.45 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one |
| PubChem CID | 172877104 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one |
| SMILES | COc1ccc(-c2cc3oc(=O)cc(C(C)C)c3c3c2C=CC(C)(C)O3)cc1 |
| InChI | InChI=1S/C24H24O4/c1-14(2)18-13-21(25)27-20-12-19(15-6-8-16(26-5)9-7-15)17-10-11-24(3,4)28-23(17)22(18)20/h6-14H,1-5H3 |
| InChIKey | KLZORYNMLMRCOO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one?
The IUPAC name of 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one (CID 172877104) is 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one.
What is the SMILES notation for 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one?
The canonical SMILES for 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one is COc1ccc(-c2cc3oc(=O)cc(C(C)C)c3c3c2C=CC(C)(C)O3)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one?
The InChIKey is KLZORYNMLMRCOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24O4/c1-14(2)18-13-21(25)27-20-12-19(15-6-8-16(26-5)9-7-15)17-10-11-24(3,4)28-23(17)22(18)20/h6-14H,1-5H3.
What are the key properties of 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one?
5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one has a molecular weight of 376.45 g/mol, XLogP of 5.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-2,2-dimethyl-10-propan-2-ylpyrano[2,3-f]chromen-8-one is sourced from PubChem (CID 172877104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).