About [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol
[6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol (PubChem CID 172877745) has the molecular formula C12H8F3NO
and a molecular weight of 239.20 g/mol. Its IUPAC name is [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol |
| PubChem CID | 172877745 |
| Molecular Formula | C12H8F3NO |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol |
| SMILES | OCc1ccc(-c2cc(F)c(F)c(F)c2)nc1 |
| InChI | InChI=1S/C12H8F3NO/c13-9-3-8(4-10(14)12(9)15)11-2-1-7(6-17)5-16-11/h1-5,17H,6H2 |
| InChIKey | IEPXGNQNDJUBNZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol?
The IUPAC name of [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol (CID 172877745) is [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol.
What is the SMILES notation for [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol?
The canonical SMILES for [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol is OCc1ccc(-c2cc(F)c(F)c(F)c2)nc1.
What is the InChIKey of [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol?
The InChIKey is IEPXGNQNDJUBNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3NO/c13-9-3-8(4-10(14)12(9)15)11-2-1-7(6-17)5-16-11/h1-5,17H,6H2.
What are the key properties of [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol?
[6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol has a molecular weight of 239.20 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(3,4,5-trifluorophenyl)-3-pyridinyl]methanol is sourced from PubChem (CID 172877745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).