About N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide
N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide (PubChem CID 172877856) has the molecular formula C11H13F2NO
and a molecular weight of 213.23 g/mol. Its IUPAC name is N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide.
Molecular Properties
| Compound Name | N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide |
| PubChem CID | 172877856 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide |
| SMILES | O=C(NC1C=CC(F)=C(F)C1)C1CCC1 |
| InChI | InChI=1S/C11H13F2NO/c12-9-5-4-8(6-10(9)13)14-11(15)7-2-1-3-7/h4-5,7-8H,1-3,6H2,(H,14,15) |
| InChIKey | PCEWBUWJWOUULU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide?
The IUPAC name of N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide (CID 172877856) is N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide.
What is the SMILES notation for N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide?
The canonical SMILES for N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide is O=C(NC1C=CC(F)=C(F)C1)C1CCC1.
What is the InChIKey of N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide?
The InChIKey is PCEWBUWJWOUULU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO/c12-9-5-4-8(6-10(9)13)14-11(15)7-2-1-3-7/h4-5,7-8H,1-3,6H2,(H,14,15).
What are the key properties of N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide?
N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide has a molecular weight of 213.23 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-difluorocyclohexa-2,4-dien-1-yl)cyclobutanecarboxamide is sourced from PubChem (CID 172877856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).