About 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one
8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one (PubChem CID 172877997) has the molecular formula C18H7F9O3
and a molecular weight of 442.23 g/mol. Its IUPAC name is 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one.
Molecular Properties
| Compound Name | 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
| PubChem CID | 172877997 |
| Molecular Formula | C18H7F9O3 |
| Molecular Weight | 442.23 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
| SMILES | O=c1cc(C(F)(F)F)oc2c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(O)ccc12 |
| InChI | InChI=1S/C18H7F9O3/c19-16(20,21)8-3-7(4-9(5-8)17(22,23)24)14-11(28)2-1-10-12(29)6-13(18(25,26)27)30-15(10)14/h1-6,28H |
| InChIKey | BXEXTEJSFHHDLW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.23 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one?
The IUPAC name of 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one (CID 172877997) is 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one.
What is the SMILES notation for 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one?
The canonical SMILES for 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one is O=c1cc(C(F)(F)F)oc2c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(O)ccc12.
What is the InChIKey of 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one?
The InChIKey is BXEXTEJSFHHDLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H7F9O3/c19-16(20,21)8-3-7(4-9(5-8)17(22,23)24)14-11(28)2-1-10-12(29)6-13(18(25,26)27)30-15(10)14/h1-6,28H.
What are the key properties of 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one?
8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one has a molecular weight of 442.23 g/mol, XLogP of 6.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[3,5-bis(trifluoromethyl)phenyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one is sourced from PubChem (CID 172877997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).