C13H11NO4 — CID 172878120
(2S)-2-cyclopropyl-2-(1,3-dioxoisoindol-2-yl)acetic acid (PubChem CID 172878120) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is (2S)-2-cyclopropyl-2-(1,3-dioxoisoindol-2-yl)acetic acid.
| Compound Name | (2S)-2-cyclopropyl-2-(1,3-dioxoisoindol-2-yl)acetic acid |
|---|---|
| PubChem CID | 172878120 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (2S)-2-cyclopropyl-2-(1,3-dioxoisoindol-2-yl)acetic acid |
| SMILES | O=C(O)[C@H](C1CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H11NO4/c15-11-8-3-1-2-4-9(8)12(16)14(11)10(13(17)18)7-5-6-7/h1-4,7,10H,5-6H2,(H,17,18)/t10-/m0/s1 |
| InChIKey | XRFVCJSZYHBAJP-JTQLQIEISA-N |
| XLogP | 1.15 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|