About 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide
2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide (PubChem CID 172878247) has the molecular formula C17H9F6N5O
and a molecular weight of 413.28 g/mol. Its IUPAC name is 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide.
Molecular Properties
| Compound Name | 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide |
| PubChem CID | 172878247 |
| Molecular Formula | C17H9F6N5O |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide |
| SMILES | NC(=O)C(=C1C=NC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)=N1)c1cncnc1 |
| InChI | InChI=1S/C17H9F6N5O/c18-16(19,20)10-1-8(2-11(3-10)17(21,22)23)15-27-6-12(28-15)13(14(24)29)9-4-25-7-26-5-9/h1-7H,(H2,24,29) |
| InChIKey | BZCQYMRTAQKVMQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide?
The IUPAC name of 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide (CID 172878247) is 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide.
What is the SMILES notation for 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide?
The canonical SMILES for 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide is NC(=O)C(=C1C=NC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)=N1)c1cncnc1.
What is the InChIKey of 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide?
The InChIKey is BZCQYMRTAQKVMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9F6N5O/c18-16(19,20)10-1-8(2-11(3-10)17(21,22)23)15-27-6-12(28-15)13(14(24)29)9-4-25-7-26-5-9/h1-7H,(H2,24,29).
What are the key properties of 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide?
2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide has a molecular weight of 413.28 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[3,5-bis(trifluoromethyl)phenyl]imidazol-4-ylidene]-2-pyrimidin-5-ylacetamide is sourced from PubChem (CID 172878247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).