C20H26N2 — CID 172879248
3-(9H-fluoren-1-yl)-1-N,1-N,1-N',1-N'-tetramethylpropane-1,1-diamine (PubChem CID 172879248) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-(9H-fluoren-1-yl)-1-N,1-N,1-N',1-N'-tetramethylpropane-1,1-diamine.
| Compound Name | 3-(9H-fluoren-1-yl)-1-N,1-N,1-N',1-N'-tetramethylpropane-1,1-diamine |
|---|---|
| PubChem CID | 172879248 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-(9H-fluoren-1-yl)-1-N,1-N,1-N',1-N'-tetramethylpropane-1,1-diamine |
| SMILES | CN(C)C(CCc1cccc2c1Cc1ccccc1-2)N(C)C |
| InChI | InChI=1S/C20H26N2/c1-21(2)20(22(3)4)13-12-15-9-7-11-18-17-10-6-5-8-16(17)14-19(15)18/h5-11,20H,12-14H2,1-4H3 |
| InChIKey | OKAUAXTYFFGVIA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|