C73H62N10O — CID 172879431
2,6-bis[[bis[[2-(4-ethenylphenyl)benzimidazol-1-yl]methyl]amino]methyl]-4-methylphenol (PubChem CID 172879431) has the molecular formula C73H62N10O and a molecular weight of 1095.37 g/mol. Its IUPAC name is 2,6-bis[[bis[[2-(4-ethenylphenyl)benzimidazol-1-yl]methyl]amino]methyl]-4-methylphenol.
| Compound Name | 2,6-bis[[bis[[2-(4-ethenylphenyl)benzimidazol-1-yl]methyl]amino]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 172879431 |
| Molecular Formula | C73H62N10O |
| Molecular Weight | 1095.37 g/mol |
| Exact Mass | 1094.51 |
| IUPAC Name | 2,6-bis[[bis[[2-(4-ethenylphenyl)benzimidazol-1-yl]methyl]amino]methyl]-4-methylphenol |
| SMILES | C=Cc1ccc(-c2nc3ccccc3n2CN(Cc2cc(C)cc(CN(Cn3c(-c4ccc(C=C)cc4)nc4ccccc43)Cn3c(-c4ccc(C=C)cc4)nc4ccccc43)c2O)Cn2c(-c3ccc(C=C)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C73H62N10O/c1-6-51-26-34-55(35-27-51)70-74-61-18-10-14-22-65(61)80(70)46-78(47-81-66-23-15-11-19-62(66)75-71(81)56-36-28-52(7-2)29-37-56)44-59-42-50(5)43-60(69(59)84)45-79(48-82-67-24-16-12-20-63(67)76-72(82)57-38-30-53(8-3)31-39-57)49-83-68-25-17-13-21-64(68)77-73(83)58-40-32-54(9-4)33-41-58/h6-43,84H,1-4,44-49H2,5H3 |
| InChIKey | SOXQVOIJZFAERF-UHFFFAOYSA-N |
| XLogP | 16.57 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.37 |
| LogP ≤ 5 | 16.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|