C27H26O3 — CID 172879843
(4aR,9bR)-2-(2-hydroxy-5-prop-2-enylphenyl)-8,9b-bis(prop-2-enyl)-4,4a-dihydrodibenzofuran-3-one (PubChem CID 172879843) has the molecular formula C27H26O3 and a molecular weight of 398.50 g/mol. Its IUPAC name is (4aR,9bR)-2-(2-hydroxy-5-prop-2-enylphenyl)-8,9b-bis(prop-2-enyl)-4,4a-dihydrodibenzofuran-3-one.
| Compound Name | (4aR,9bR)-2-(2-hydroxy-5-prop-2-enylphenyl)-8,9b-bis(prop-2-enyl)-4,4a-dihydrodibenzofuran-3-one |
|---|---|
| PubChem CID | 172879843 |
| Molecular Formula | C27H26O3 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (4aR,9bR)-2-(2-hydroxy-5-prop-2-enylphenyl)-8,9b-bis(prop-2-enyl)-4,4a-dihydrodibenzofuran-3-one |
| SMILES | C=CCc1ccc(O)c(C2=C[C@]3(CC=C)c4cc(CC=C)ccc4O[C@@H]3CC2=O)c1 |
| InChI | InChI=1S/C27H26O3/c1-4-7-18-9-11-23(28)20(14-18)21-17-27(13-6-3)22-15-19(8-5-2)10-12-25(22)30-26(27)16-24(21)29/h4-6,9-12,14-15,17,26,28H,1-3,7-8,13,16H2/t26-,27-/m1/s1 |
| InChIKey | NHYWMDUNLRSEAE-KAYWLYCHSA-N |
| XLogP | 5.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|