C18H23FN6 — CID 172881074
N-[1-(6-cyclobutyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]-6-methylpyrimidin-4-amine (PubChem CID 172881074) has the molecular formula C18H23FN6 and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[1-(6-cyclobutyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]-6-methylpyrimidin-4-amine.
| Compound Name | N-[1-(6-cyclobutyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 172881074 |
| Molecular Formula | C18H23FN6 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | N-[1-(6-cyclobutyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NC2CCCN(c3ncnc(C4CCC4)c3F)C2)ncn1 |
| InChI | InChI=1S/C18H23FN6/c1-12-8-15(21-10-20-12)24-14-6-3-7-25(9-14)18-16(19)17(22-11-23-18)13-4-2-5-13/h8,10-11,13-14H,2-7,9H2,1H3,(H,20,21,24) |
| InChIKey | HDGUGIYPFFAHTP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |