About N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine
N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine (PubChem CID 172881471) has the molecular formula C14H19N5S
and a molecular weight of 289.41 g/mol. Its IUPAC name is N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine |
| PubChem CID | 172881471 |
| Molecular Formula | C14H19N5S |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine |
| SMILES | Cc1ncsc1CN1CCCC(Nc2ccncn2)C1 |
| InChI | InChI=1S/C14H19N5S/c1-11-13(20-10-17-11)8-19-6-2-3-12(7-19)18-14-4-5-15-9-16-14/h4-5,9-10,12H,2-3,6-8H2,1H3,(H,15,16,18) |
| InChIKey | TVNDVOOHINRDLY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine?
The IUPAC name of N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine (CID 172881471) is N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine.
What is the SMILES notation for N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine?
The canonical SMILES for N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine is Cc1ncsc1CN1CCCC(Nc2ccncn2)C1.
What is the InChIKey of N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine?
The InChIKey is TVNDVOOHINRDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5S/c1-11-13(20-10-17-11)8-19-6-2-3-12(7-19)18-14-4-5-15-9-16-14/h4-5,9-10,12H,2-3,6-8H2,1H3,(H,15,16,18).
What are the key properties of N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine?
N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine has a molecular weight of 289.41 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(4-methyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]pyrimidin-4-amine is sourced from PubChem (CID 172881471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).