About 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide
3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide (PubChem CID 172882805) has the molecular formula C18H16N6O
and a molecular weight of 332.37 g/mol. Its IUPAC name is 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide.
Molecular Properties
| Compound Name | 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide |
| PubChem CID | 172882805 |
| Molecular Formula | C18H16N6O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1cccc(C#N)c1)C1CN(c2ccc3nccn3n2)C1 |
| InChI | InChI=1S/C18H16N6O/c1-22(18(25)14-4-2-3-13(9-14)10-19)15-11-23(12-15)17-6-5-16-20-7-8-24(16)21-17/h2-9,15H,11-12H2,1H3 |
| InChIKey | CNTWTTAZIBGWPW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide?
The IUPAC name of 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide (CID 172882805) is 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide.
What is the SMILES notation for 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide?
The canonical SMILES for 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide is CN(C(=O)c1cccc(C#N)c1)C1CN(c2ccc3nccn3n2)C1.
What is the InChIKey of 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide?
The InChIKey is CNTWTTAZIBGWPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6O/c1-22(18(25)14-4-2-3-13(9-14)10-19)15-11-23(12-15)17-6-5-16-20-7-8-24(16)21-17/h2-9,15H,11-12H2,1H3.
What are the key properties of 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide?
3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide has a molecular weight of 332.37 g/mol, XLogP of 1.56, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-(1-imidazo[1,2-b]pyridazin-6-ylazetidin-3-yl)-N-methylbenzamide is sourced from PubChem (CID 172882805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).