About [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride
[3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride (PubChem CID 172883217) has the molecular formula C7H8Cl2F5NS
and a molecular weight of 304.11 g/mol. Its IUPAC name is [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride |
| PubChem CID | 172883217 |
| Molecular Formula | C7H8Cl2F5NS |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride |
| SMILES | Cl.NCc1cc(Cl)cc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C7H7ClF5NS.ClH/c8-6-1-5(4-14)2-7(3-6)15(9,10,11,12)13;/h1-3H,4,14H2;1H |
| InChIKey | POIBCPTYOXBGAQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride?
The IUPAC name of [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride (CID 172883217) is [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride.
What is the SMILES notation for [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride?
The canonical SMILES for [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride is Cl.NCc1cc(Cl)cc(S(F)(F)(F)(F)F)c1.
What is the InChIKey of [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride?
The InChIKey is POIBCPTYOXBGAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClF5NS.ClH/c8-6-1-5(4-14)2-7(3-6)15(9,10,11,12)13;/h1-3H,4,14H2;1H.
What are the key properties of [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride?
[3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride has a molecular weight of 304.11 g/mol, XLogP of 4.88, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-5-(pentafluoro-λ6-sulfanyl)phenyl]methanamine;hydrochloride is sourced from PubChem (CID 172883217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).