C24H26N6O3 — CID 172884279
1-[(4R,7S,8aS)-1-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-benzylurea (PubChem CID 172884279) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-[(4R,7S,8aS)-1-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-benzylurea.
| Compound Name | 1-[(4R,7S,8aS)-1-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-benzylurea |
|---|---|
| PubChem CID | 172884279 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 1-[(4R,7S,8aS)-1-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-benzylurea |
| SMILES | O=C(NCc1ccccc1)N[C@H]1C[C@H]2C(=O)NC[C@@H](Cc3nnc(-c4ccccc4)o3)N2C1 |
| InChI | InChI=1S/C24H26N6O3/c31-22-20-11-18(27-24(32)26-13-16-7-3-1-4-8-16)15-30(20)19(14-25-22)12-21-28-29-23(33-21)17-9-5-2-6-10-17/h1-10,18-20H,11-15H2,(H,25,31)(H2,26,27,32)/t18-,19+,20-/m0/s1 |
| InChIKey | ASMZFMTYKLPRIE-ZCNNSNEGSA-N |
| XLogP | 1.72 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |