C19H25N5O3 — CID 172884387
(4R,7S,8aS)-7-(dimethylamino)-4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 172884387) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (4R,7S,8aS)-7-(dimethylamino)-4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | (4R,7S,8aS)-7-(dimethylamino)-4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 172884387 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (4R,7S,8aS)-7-(dimethylamino)-4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | COc1ccc(-c2nnc(C[C@@H]3CNC(=O)[C@@H]4C[C@H](N(C)C)CN34)o2)cc1 |
| InChI | InChI=1S/C19H25N5O3/c1-23(2)14-8-16-18(25)20-10-13(24(16)11-14)9-17-21-22-19(27-17)12-4-6-15(26-3)7-5-12/h4-7,13-14,16H,8-11H2,1-3H3,(H,20,25)/t13-,14+,16+/m1/s1 |
| InChIKey | TXQWDMMZDXQOQR-YCPHGPKFSA-N |
| XLogP | 0.79 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |