About cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone
cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone (PubChem CID 172884685) has the molecular formula C19H32N2O4
and a molecular weight of 352.48 g/mol. Its IUPAC name is cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone.
Molecular Properties
| Compound Name | cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone |
| PubChem CID | 172884685 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CCOC2(C1)CN(C1CCOCC1)CCCO2 |
| InChI | InChI=1S/C19H32N2O4/c22-18(16-4-1-2-5-16)21-9-13-25-19(15-21)14-20(8-3-10-24-19)17-6-11-23-12-7-17/h16-17H,1-15H2 |
| InChIKey | HOUOMEUOKDWCMT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone?
The IUPAC name of cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone (CID 172884685) is cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone.
What is the SMILES notation for cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone?
The canonical SMILES for cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone is O=C(C1CCCC1)N1CCOC2(C1)CN(C1CCOCC1)CCCO2.
What is the InChIKey of cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone?
The InChIKey is HOUOMEUOKDWCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O4/c22-18(16-4-1-2-5-16)21-9-13-25-19(15-21)14-20(8-3-10-24-19)17-6-11-23-12-7-17/h16-17H,1-15H2.
What are the key properties of cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone?
cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone has a molecular weight of 352.48 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-[8-(oxan-4-yl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]methanone is sourced from PubChem (CID 172884685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).