About 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone
1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone (PubChem CID 172884695) has the molecular formula C16H26N2O4
and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone |
| PubChem CID | 172884695 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone |
| SMILES | CC(=O)N1CCCOC2(C1)CN(C(=O)C1CCCC1)CCO2 |
| InChI | InChI=1S/C16H26N2O4/c1-13(19)17-7-4-9-21-16(11-17)12-18(8-10-22-16)15(20)14-5-2-3-6-14/h14H,2-12H2,1H3 |
| InChIKey | QXNVEKSZMYMJEN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone?
The IUPAC name of 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone (CID 172884695) is 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone.
What is the SMILES notation for 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone?
The canonical SMILES for 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone is CC(=O)N1CCCOC2(C1)CN(C(=O)C1CCCC1)CCO2.
What is the InChIKey of 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone?
The InChIKey is QXNVEKSZMYMJEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O4/c1-13(19)17-7-4-9-21-16(11-17)12-18(8-10-22-16)15(20)14-5-2-3-6-14/h14H,2-12H2,1H3.
What are the key properties of 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone?
1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone has a molecular weight of 310.39 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(cyclopentanecarbonyl)-1,12-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanone is sourced from PubChem (CID 172884695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).