About (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride
(3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride (PubChem CID 172885136) has the molecular formula C5H11ClF2N2OS
and a molecular weight of 220.67 g/mol. Its IUPAC name is (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride.
Molecular Properties
| Compound Name | (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride |
| PubChem CID | 172885136 |
| Molecular Formula | C5H11ClF2N2OS |
| Molecular Weight | 220.67 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride |
| SMILES | Cl.[H]N=S(C)(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C5H10F2N2OS.ClH/c1-11(8,10)9-3-2-5(6,7)4-9;/h8H,2-4H2,1H3;1H |
| InChIKey | YJQPGPMPLHIEOY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.67 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride?
The IUPAC name of (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride (CID 172885136) is (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride.
What is the SMILES notation for (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride?
The canonical SMILES for (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride is Cl.[H]N=S(C)(=O)N1CCC(F)(F)C1.
What is the InChIKey of (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride?
The InChIKey is YJQPGPMPLHIEOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F2N2OS.ClH/c1-11(8,10)9-3-2-5(6,7)4-9;/h8H,2-4H2,1H3;1H.
What are the key properties of (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride?
(3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride has a molecular weight of 220.67 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluoropyrrolidin-1-yl)-imino-methyl-oxo-λ6-sulfane;hydrochloride is sourced from PubChem (CID 172885136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).