C18H24ClN3O10P2 — CID 172885329
N'-[5-(4-chlorophenoxy)-6-methoxyquinolin-8-yl]ethane-1,2-diamine;phosphoric acid (PubChem CID 172885329) has the molecular formula C18H24ClN3O10P2 and a molecular weight of 539.80 g/mol. Its IUPAC name is N'-[5-(4-chlorophenoxy)-6-methoxyquinolin-8-yl]ethane-1,2-diamine;phosphoric acid.
| Compound Name | N'-[5-(4-chlorophenoxy)-6-methoxyquinolin-8-yl]ethane-1,2-diamine;phosphoric acid |
|---|---|
| PubChem CID | 172885329 |
| Molecular Formula | C18H24ClN3O10P2 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | N'-[5-(4-chlorophenoxy)-6-methoxyquinolin-8-yl]ethane-1,2-diamine;phosphoric acid |
| SMILES | COc1cc(NCCN)c2ncccc2c1Oc1ccc(Cl)cc1.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C18H18ClN3O2.2H3O4P/c1-23-16-11-15(21-10-8-20)17-14(3-2-9-22-17)18(16)24-13-6-4-12(19)5-7-13;2*1-5(2,3)4/h2-7,9,11,21H,8,10,20H2,1H3;2*(H3,1,2,3,4) |
| InChIKey | XQSXCEGXJRPIQF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 224.92 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|