C28H31ClN2O8S — CID 172885403
(Z)-but-2-enedioic acid;4-[2-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazin-1-yl]ethoxy]-4-oxobutanoic acid (PubChem CID 172885403) has the molecular formula C28H31ClN2O8S and a molecular weight of 591.08 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-[2-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazin-1-yl]ethoxy]-4-oxobutanoic acid.
| Compound Name | (Z)-but-2-enedioic acid;4-[2-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazin-1-yl]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 172885403 |
| Molecular Formula | C28H31ClN2O8S |
| Molecular Weight | 591.08 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-[2-[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazin-1-yl]ethoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)/C=C\C(=O)O.O=C(O)CCC(=O)OCCN1CCN(C2Cc3cc(Cl)ccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C24H27ClN2O4S.C4H4O4/c25-18-5-6-21-17(15-18)16-20(19-3-1-2-4-22(19)32-21)27-11-9-26(10-12-27)13-14-31-24(30)8-7-23(28)29;5-3(6)1-2-4(7)8/h1-6,15,20H,7-14,16H2,(H,28,29);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | RFRHHLDUGAIOFI-BTJKTKAUSA-N |
| XLogP | 3.83 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.08 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|