C18H18F2N6O2S — CID 17288635
2-[[4-amino-5-[(4-methoxyanilino)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-difluorophenyl)acetamide (PubChem CID 17288635) has the molecular formula C18H18F2N6O2S and a molecular weight of 420.45 g/mol. Its IUPAC name is 2-[[4-amino-5-[(4-methoxyanilino)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(4-methoxyanilino)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 17288635 |
| Molecular Formula | C18H18F2N6O2S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-[[4-amino-5-[(4-methoxyanilino)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-difluorophenyl)acetamide |
| SMILES | COc1ccc(NCc2nnc(SCC(=O)Nc3c(F)cccc3F)n2N)cc1 |
| InChI | InChI=1S/C18H18F2N6O2S/c1-28-12-7-5-11(6-8-12)22-9-15-24-25-18(26(15)21)29-10-16(27)23-17-13(19)3-2-4-14(17)20/h2-8,22H,9-10,21H2,1H3,(H,23,27) |
| InChIKey | BZPDQUXCAAFGOV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|