C16H20ClN3O3 — CID 172887313
1-[4-(5-chloro-2-methoxypyridine-3-carbonyl)-3-ethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 172887313) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 1-[4-(5-chloro-2-methoxypyridine-3-carbonyl)-3-ethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(5-chloro-2-methoxypyridine-3-carbonyl)-3-ethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172887313 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[4-(5-chloro-2-methoxypyridine-3-carbonyl)-3-ethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)c2cc(Cl)cnc2OC)C(CC)C1 |
| InChI | InChI=1S/C16H20ClN3O3/c1-4-12-10-19(14(21)5-2)6-7-20(12)16(22)13-8-11(17)9-18-15(13)23-3/h5,8-9,12H,2,4,6-7,10H2,1,3H3 |
| InChIKey | TWZQUCPZTZLJIO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|