C23H27N3O3 — CID 172887559
1-[(3-methylphenyl)methyl]-3-[2-(1-prop-2-enoylpiperidin-4-yl)oxyphenyl]urea (PubChem CID 172887559) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-3-[2-(1-prop-2-enoylpiperidin-4-yl)oxyphenyl]urea.
| Compound Name | 1-[(3-methylphenyl)methyl]-3-[2-(1-prop-2-enoylpiperidin-4-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 172887559 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-3-[2-(1-prop-2-enoylpiperidin-4-yl)oxyphenyl]urea |
| SMILES | C=CC(=O)N1CCC(Oc2ccccc2NC(=O)NCc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C23H27N3O3/c1-3-22(27)26-13-11-19(12-14-26)29-21-10-5-4-9-20(21)25-23(28)24-16-18-8-6-7-17(2)15-18/h3-10,15,19H,1,11-14,16H2,2H3,(H2,24,25,28) |
| InChIKey | KQLHEQUIJPCUEM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|