C17H18F5N3O2 — CID 172887673
N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-3-[4-(trifluoromethyl)-3-pyridinyl]propanamide (PubChem CID 172887673) has the molecular formula C17H18F5N3O2 and a molecular weight of 391.34 g/mol. Its IUPAC name is N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-3-[4-(trifluoromethyl)-3-pyridinyl]propanamide.
| Compound Name | N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-3-[4-(trifluoromethyl)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 172887673 |
| Molecular Formula | C17H18F5N3O2 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-[(3R)-4,4-difluoro-1-prop-2-enoylpiperidin-3-yl]-3-[4-(trifluoromethyl)-3-pyridinyl]propanamide |
| SMILES | C=CC(=O)N1CCC(F)(F)[C@H](NC(=O)CCc2cnccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H18F5N3O2/c1-2-15(27)25-8-6-16(18,19)13(10-25)24-14(26)4-3-11-9-23-7-5-12(11)17(20,21)22/h2,5,7,9,13H,1,3-4,6,8,10H2,(H,24,26)/t13-/m1/s1 |
| InChIKey | AHMUTGCPFMPPBH-CYBMUJFWSA-N |
| XLogP | 2.57 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|