C17H19F3N2O2 — CID 172888872
N-[4-methyl-2-(trifluoromethyl)phenyl]-1-prop-2-enoylpiperidine-4-carboxamide (PubChem CID 172888872) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is N-[4-methyl-2-(trifluoromethyl)phenyl]-1-prop-2-enoylpiperidine-4-carboxamide.
| Compound Name | N-[4-methyl-2-(trifluoromethyl)phenyl]-1-prop-2-enoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 172888872 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[4-methyl-2-(trifluoromethyl)phenyl]-1-prop-2-enoylpiperidine-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(C(=O)Nc2ccc(C)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H19F3N2O2/c1-3-15(23)22-8-6-12(7-9-22)16(24)21-14-5-4-11(2)10-13(14)17(18,19)20/h3-5,10,12H,1,6-9H2,2H3,(H,21,24) |
| InChIKey | STVLHHGFBNPWDT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|