About 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one
1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one (PubChem CID 172888989) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one |
| PubChem CID | 172888989 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC1C(=O)N1CCC2(CC1)COc1ccccc12 |
| InChI | InChI=1S/C19H22N2O3/c1-2-17(22)21-10-7-15(21)18(23)20-11-8-19(9-12-20)13-24-16-6-4-3-5-14(16)19/h2-6,15H,1,7-13H2 |
| InChIKey | UYJHDTZCLNJQJX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one?
The IUPAC name of 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one (CID 172888989) is 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one.
What is the SMILES notation for 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one?
The canonical SMILES for 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one is C=CC(=O)N1CCC1C(=O)N1CCC2(CC1)COc1ccccc12.
What is the InChIKey of 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one?
The InChIKey is UYJHDTZCLNJQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-2-17(22)21-10-7-15(21)18(23)20-11-8-19(9-12-20)13-24-16-6-4-3-5-14(16)19/h2-6,15H,1,7-13H2.
What are the key properties of 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one?
1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one has a molecular weight of 326.40 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl)azetidin-1-yl]prop-2-en-1-one is sourced from PubChem (CID 172888989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).