C21H24N4O2 — CID 172889285
1-[(2R)-2-(4-quinolin-2-ylpiperazine-1-carbonyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 172889285) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[(2R)-2-(4-quinolin-2-ylpiperazine-1-carbonyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-2-(4-quinolin-2-ylpiperazine-1-carbonyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172889285 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-[(2R)-2-(4-quinolin-2-ylpiperazine-1-carbonyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H]1C(=O)N1CCN(c2ccc3ccccc3n2)CC1 |
| InChI | InChI=1S/C21H24N4O2/c1-2-20(26)25-11-5-8-18(25)21(27)24-14-12-23(13-15-24)19-10-9-16-6-3-4-7-17(16)22-19/h2-4,6-7,9-10,18H,1,5,8,11-15H2/t18-/m1/s1 |
| InChIKey | AXAMPTLJDAAXCX-GOSISDBHSA-N |
| XLogP | 2.06 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|