C19H22N4O3 — CID 172889365
1-[(2R)-4-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoyl]-2-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 172889365) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[(2R)-4-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoyl]-2-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-4-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172889365 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[(2R)-4-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)c2ccc(-c3noc(CC)n3)cc2)C[C@H]1C |
| InChI | InChI=1S/C19H22N4O3/c1-4-16-20-18(21-26-16)14-6-8-15(9-7-14)19(25)22-10-11-23(13(3)12-22)17(24)5-2/h5-9,13H,2,4,10-12H2,1,3H3/t13-/m1/s1 |
| InChIKey | ZYFWSCPKNXGMTF-CYBMUJFWSA-N |
| XLogP | 2.16 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|