C22H22ClN3O3 — CID 172889490
N-(2-chlorophenyl)-4-[[2-[(2R)-1-prop-2-enoylpyrrolidin-2-yl]acetyl]amino]benzamide (PubChem CID 172889490) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[[2-[(2R)-1-prop-2-enoylpyrrolidin-2-yl]acetyl]amino]benzamide.
| Compound Name | N-(2-chlorophenyl)-4-[[2-[(2R)-1-prop-2-enoylpyrrolidin-2-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 172889490 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-(2-chlorophenyl)-4-[[2-[(2R)-1-prop-2-enoylpyrrolidin-2-yl]acetyl]amino]benzamide |
| SMILES | C=CC(=O)N1CCC[C@@H]1CC(=O)Nc1ccc(C(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-2-21(28)26-13-5-6-17(26)14-20(27)24-16-11-9-15(10-12-16)22(29)25-19-8-4-3-7-18(19)23/h2-4,7-12,17H,1,5-6,13-14H2,(H,24,27)(H,25,29)/t17-/m1/s1 |
| InChIKey | PRPXVPMTFKYGRF-QGZVFWFLSA-N |
| XLogP | 4.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|