C22H21N3O3 — CID 172889642
N-[4-(4-cyanophenoxy)phenyl]-2-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]acetamide (PubChem CID 172889642) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[4-(4-cyanophenoxy)phenyl]-2-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]acetamide.
| Compound Name | N-[4-(4-cyanophenoxy)phenyl]-2-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 172889642 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[4-(4-cyanophenoxy)phenyl]-2-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]acetamide |
| SMILES | C=CC(=O)N1CC[C@@H](CC(=O)Nc2ccc(Oc3ccc(C#N)cc3)cc2)C1 |
| InChI | InChI=1S/C22H21N3O3/c1-2-22(27)25-12-11-17(15-25)13-21(26)24-18-5-9-20(10-6-18)28-19-7-3-16(14-23)4-8-19/h2-10,17H,1,11-13,15H2,(H,24,26)/t17-/m0/s1 |
| InChIKey | BENMQABBTUHWBQ-KRWDZBQOSA-N |
| XLogP | 3.71 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|