C8H14F2N2 — CID 172890853
1-[(E)-4,4-difluorobut-2-enyl]piperazine (PubChem CID 172890853) has the molecular formula C8H14F2N2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 1-[(E)-4,4-difluorobut-2-enyl]piperazine.
| Compound Name | 1-[(E)-4,4-difluorobut-2-enyl]piperazine |
|---|---|
| PubChem CID | 172890853 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-[(E)-4,4-difluorobut-2-enyl]piperazine |
| SMILES | FC(F)/C=C/CN1CCNCC1 |
| InChI | InChI=1S/C8H14F2N2/c9-8(10)2-1-5-12-6-3-11-4-7-12/h1-2,8,11H,3-7H2/b2-1+ |
| InChIKey | OERCSKAHAJBTQJ-OWOJBTEDSA-N |
| XLogP | 0.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|