C18H19N5O — CID 172891354
2-(2-methyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 172891354) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-(2-methyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-(2-methyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 172891354 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-(2-methyl-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1nc2c(c(=O)[nH]1)CN(c1nc3c(cc1C#N)CCCC3)CC2 |
| InChI | InChI=1S/C18H19N5O/c1-11-20-16-6-7-23(10-14(16)18(24)21-11)17-13(9-19)8-12-4-2-3-5-15(12)22-17/h8H,2-7,10H2,1H3,(H,20,21,24) |
| InChIKey | XGDLMGZBSPHGJR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |