C14H16ClN5 — CID 172893095
N-[1-[(6-chloro-3-pyridinyl)methyl]pyrrolidin-3-yl]pyrimidin-2-amine (PubChem CID 172893095) has the molecular formula C14H16ClN5 and a molecular weight of 289.77 g/mol. Its IUPAC name is N-[1-[(6-chloro-3-pyridinyl)methyl]pyrrolidin-3-yl]pyrimidin-2-amine.
| Compound Name | N-[1-[(6-chloro-3-pyridinyl)methyl]pyrrolidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 172893095 |
| Molecular Formula | C14H16ClN5 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[1-[(6-chloro-3-pyridinyl)methyl]pyrrolidin-3-yl]pyrimidin-2-amine |
| SMILES | Clc1ccc(CN2CCC(Nc3ncccn3)C2)cn1 |
| InChI | InChI=1S/C14H16ClN5/c15-13-3-2-11(8-18-13)9-20-7-4-12(10-20)19-14-16-5-1-6-17-14/h1-3,5-6,8,12H,4,7,9-10H2,(H,16,17,19) |
| InChIKey | SPWRVCHBHFAFNW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|