C17H22ClN5 — CID 172893331
N-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-3-yl]-N,4-dimethylpyrimidin-2-amine (PubChem CID 172893331) has the molecular formula C17H22ClN5 and a molecular weight of 331.85 g/mol. Its IUPAC name is N-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-3-yl]-N,4-dimethylpyrimidin-2-amine.
| Compound Name | N-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-3-yl]-N,4-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 172893331 |
| Molecular Formula | C17H22ClN5 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-3-yl]-N,4-dimethylpyrimidin-2-amine |
| SMILES | Cc1ccnc(N(C)C2CCCN(Cc3ccc(Cl)nc3)C2)n1 |
| InChI | InChI=1S/C17H22ClN5/c1-13-7-8-19-17(21-13)22(2)15-4-3-9-23(12-15)11-14-5-6-16(18)20-10-14/h5-8,10,15H,3-4,9,11-12H2,1-2H3 |
| InChIKey | VQIMLANBRGFNTA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|