About 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide
2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide (PubChem CID 172894497) has the molecular formula C18H20F3N3O3
and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide.
Molecular Properties
| Compound Name | 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide |
| PubChem CID | 172894497 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide |
| SMILES | C=CC(=O)N1CC(NC(=O)C(C)(NC(C)=O)c2ccccc2F)C(F)(F)C1 |
| InChI | InChI=1S/C18H20F3N3O3/c1-4-15(26)24-9-14(18(20,21)10-24)22-16(27)17(3,23-11(2)25)12-7-5-6-8-13(12)19/h4-8,14H,1,9-10H2,2-3H3,(H,22,27)(H,23,25) |
| InChIKey | YPIVJYRHHHQMPD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide?
The IUPAC name of 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide (CID 172894497) is 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide.
What is the SMILES notation for 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide?
The canonical SMILES for 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide is C=CC(=O)N1CC(NC(=O)C(C)(NC(C)=O)c2ccccc2F)C(F)(F)C1.
What is the InChIKey of 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide?
The InChIKey is YPIVJYRHHHQMPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20F3N3O3/c1-4-15(26)24-9-14(18(20,21)10-24)22-16(27)17(3,23-11(2)25)12-7-5-6-8-13(12)19/h4-8,14H,1,9-10H2,2-3H3,(H,22,27)(H,23,25).
What are the key properties of 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide?
2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide has a molecular weight of 383.37 g/mol, XLogP of 1.33, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)-2-(2-fluorophenyl)propanamide is sourced from PubChem (CID 172894497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).