C20H25N3O3 — CID 172894620
1-[4-[4-(1-aminocyclobutyl)phenyl]phenyl]-3-ethylurea;formic acid (PubChem CID 172894620) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[4-[4-(1-aminocyclobutyl)phenyl]phenyl]-3-ethylurea;formic acid.
| Compound Name | 1-[4-[4-(1-aminocyclobutyl)phenyl]phenyl]-3-ethylurea;formic acid |
|---|---|
| PubChem CID | 172894620 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-[4-[4-(1-aminocyclobutyl)phenyl]phenyl]-3-ethylurea;formic acid |
| SMILES | CCNC(=O)Nc1ccc(-c2ccc(C3(N)CCC3)cc2)cc1.O=CO |
| InChI | InChI=1S/C19H23N3O.CH2O2/c1-2-21-18(23)22-17-10-6-15(7-11-17)14-4-8-16(9-5-14)19(20)12-3-13-19;2-1-3/h4-11H,2-3,12-13,20H2,1H3,(H2,21,22,23);1H,(H,2,3) |
| InChIKey | AIEFPCZUKCAELM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|