C19H22N4O3 — CID 172895482
formic acid;1-[4-(furan-2-yl)phenyl]-4-(1H-pyrazol-5-ylmethyl)piperazine (PubChem CID 172895482) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is formic acid;1-[4-(furan-2-yl)phenyl]-4-(1H-pyrazol-5-ylmethyl)piperazine.
| Compound Name | formic acid;1-[4-(furan-2-yl)phenyl]-4-(1H-pyrazol-5-ylmethyl)piperazine |
|---|---|
| PubChem CID | 172895482 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | formic acid;1-[4-(furan-2-yl)phenyl]-4-(1H-pyrazol-5-ylmethyl)piperazine |
| SMILES | O=CO.c1coc(-c2ccc(N3CCN(Cc4ccn[nH]4)CC3)cc2)c1 |
| InChI | InChI=1S/C18H20N4O.CH2O2/c1-2-18(23-13-1)15-3-5-17(6-4-15)22-11-9-21(10-12-22)14-16-7-8-19-20-16;2-1-3/h1-8,13H,9-12,14H2,(H,19,20);1H,(H,2,3) |
| InChIKey | YXVYQKQRRSYXGH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|