C22H26N4O2 — CID 172895728
1-[3-benzyl-4-(4,5,6,7-tetrahydro-1H-indazole-3-carbonyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 172895728) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-[3-benzyl-4-(4,5,6,7-tetrahydro-1H-indazole-3-carbonyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-benzyl-4-(4,5,6,7-tetrahydro-1H-indazole-3-carbonyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172895728 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-[3-benzyl-4-(4,5,6,7-tetrahydro-1H-indazole-3-carbonyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)c2n[nH]c3c2CCCC3)C(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H26N4O2/c1-2-20(27)25-12-13-26(17(15-25)14-16-8-4-3-5-9-16)22(28)21-18-10-6-7-11-19(18)23-24-21/h2-5,8-9,17H,1,6-7,10-15H2,(H,23,24) |
| InChIKey | WAPPZDXGRPOGRG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|